C18H28ClNO2 — CID 24843033
(1-methyl-4-phenyl-2-propylpiperidin-4-yl) propanoate;hydrochloride (PubChem CID 24843033) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is (1-methyl-4-phenyl-2-propylpiperidin-4-yl) propanoate;hydrochloride.
| Compound Name | (1-methyl-4-phenyl-2-propylpiperidin-4-yl) propanoate;hydrochloride |
|---|---|
| PubChem CID | 24843033 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (1-methyl-4-phenyl-2-propylpiperidin-4-yl) propanoate;hydrochloride |
| SMILES | CCCC1CC(OC(=O)CC)(c2ccccc2)CCN1C.Cl |
| InChI | InChI=1S/C18H27NO2.ClH/c1-4-9-16-14-18(12-13-19(16)3,21-17(20)5-2)15-10-7-6-8-11-15;/h6-8,10-11,16H,4-5,9,12-14H2,1-3H3;1H |
| InChIKey | OSEFBOFBTXKWFR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |