C34H58N4O8S — CID 24843514
bis([2,2-dimethyl-3-(pentylamino)propyl] 4-aminobenzoate);sulfuric acid (PubChem CID 24843514) has the molecular formula C34H58N4O8S and a molecular weight of 682.93 g/mol. Its IUPAC name is bis([2,2-dimethyl-3-(pentylamino)propyl] 4-aminobenzoate);sulfuric acid.
| Compound Name | bis([2,2-dimethyl-3-(pentylamino)propyl] 4-aminobenzoate);sulfuric acid |
|---|---|
| PubChem CID | 24843514 |
| Molecular Formula | C34H58N4O8S |
| Molecular Weight | 682.93 g/mol |
| Exact Mass | 682.40 |
| IUPAC Name | bis([2,2-dimethyl-3-(pentylamino)propyl] 4-aminobenzoate);sulfuric acid |
| SMILES | CCCCCNCC(C)(C)COC(=O)c1ccc(N)cc1.CCCCCNCC(C)(C)COC(=O)c1ccc(N)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C17H28N2O2.H2O4S/c2*1-4-5-6-11-19-12-17(2,3)13-21-16(20)14-7-9-15(18)10-8-14;1-5(2,3)4/h2*7-10,19H,4-6,11-13,18H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | JCOILXZZXBMWFQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 203.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.93 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|