C22H29Cl2N3O2 — CID 24845907
5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one;dihydrochloride (PubChem CID 24845907) has the molecular formula C22H29Cl2N3O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is 5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one;dihydrochloride.
| Compound Name | 5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 24845907 |
| Molecular Formula | C22H29Cl2N3O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CCc2c(cccc2OCCCN2CCN(c3ccccc3)CC2)N1 |
| InChI | InChI=1S/C22H27N3O2.2ClH/c26-22-11-10-19-20(23-22)8-4-9-21(19)27-17-5-12-24-13-15-25(16-14-24)18-6-2-1-3-7-18;;/h1-4,6-9H,5,10-17H2,(H,23,26);2*1H |
| InChIKey | DAYOMAQYQQGSOL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|