C24H31N2O2+ — CID 13064810
5-[3-(1-methyl-4-phenylpiperidin-1-ium-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 13064810) has the molecular formula C24H31N2O2+ and a molecular weight of 379.52 g/mol. Its IUPAC name is 5-[3-(1-methyl-4-phenylpiperidin-1-ium-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[3-(1-methyl-4-phenylpiperidin-1-ium-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13064810 |
| Molecular Formula | C24H31N2O2+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 5-[3-(1-methyl-4-phenylpiperidin-1-ium-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C[N+]1(CCCOc2cccc3c2CCC(=O)N3)CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-26(16-13-20(14-17-26)19-7-3-2-4-8-19)15-6-18-28-23-10-5-9-22-21(23)11-12-24(27)25-22/h2-5,7-10,20H,6,11-18H2,1H3/p+1 |
| InChIKey | OYZXJEXMUNTLDB-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|