C19H21NO2S — CID 20540021
5-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 20540021) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is 5-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20540021 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(cccc2OC(S)CCCc2ccccc2)N1 |
| InChI | InChI=1S/C19H21NO2S/c21-18-13-12-15-16(20-18)9-5-10-17(15)22-19(23)11-4-8-14-6-2-1-3-7-14/h1-3,5-7,9-10,19,23H,4,8,11-13H2,(H,20,21) |
| InChIKey | PVNZKFAZTODLAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|