C19H19NO2S — CID 20539986
5-(4-phenyl-1-sulfanylbutoxy)-1H-quinolin-2-one (PubChem CID 20539986) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is 5-(4-phenyl-1-sulfanylbutoxy)-1H-quinolin-2-one.
| Compound Name | 5-(4-phenyl-1-sulfanylbutoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20539986 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(4-phenyl-1-sulfanylbutoxy)-1H-quinolin-2-one |
| SMILES | O=c1ccc2c(OC(S)CCCc3ccccc3)cccc2[nH]1 |
| InChI | InChI=1S/C19H19NO2S/c21-18-13-12-15-16(20-18)9-5-10-17(15)22-19(23)11-4-8-14-6-2-1-3-7-14/h1-3,5-7,9-10,12-13,19,23H,4,8,11H2,(H,20,21) |
| InChIKey | VNFHSBIKNYCNAJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|