C22H32N2O4 — CID 54203867
N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]butanamide (PubChem CID 54203867) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]butanamide.
| Compound Name | N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]butanamide |
|---|---|
| PubChem CID | 54203867 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]butanamide |
| SMILES | O=C1CCc2c(cccc2OCCCC(=O)N(CCO)CC2CCCCC2)N1 |
| InChI | InChI=1S/C22H32N2O4/c25-14-13-24(16-17-6-2-1-3-7-17)22(27)10-5-15-28-20-9-4-8-19-18(20)11-12-21(26)23-19/h4,8-9,17,25H,1-3,5-7,10-16H2,(H,23,26) |
| InChIKey | PRDIZEWSKNQZMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|