C25H30N2O2 — CID 24845914
2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-N-(4-benzoyl-2-methylphenyl)acetamide (PubChem CID 24845914) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-N-(4-benzoyl-2-methylphenyl)acetamide.
| Compound Name | 2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-N-(4-benzoyl-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 24845914 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-N-(4-benzoyl-2-methylphenyl)acetamide |
| SMILES | Cc1cc(C(=O)c2ccccc2)ccc1NC(=O)CC1CCCN2CCCCC12 |
| InChI | InChI=1S/C25H30N2O2/c1-18-16-21(25(29)19-8-3-2-4-9-19)12-13-22(18)26-24(28)17-20-10-7-15-27-14-6-5-11-23(20)27/h2-4,8-9,12-13,16,20,23H,5-7,10-11,14-15,17H2,1H3,(H,26,28) |
| InChIKey | UYQFMKJXWOUBBI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |