C18H28Cl2N4O2S — CID 24846272
4-amino-N-[2-(diethylamino)ethyl]-N-(pyridin-4-ylmethyl)benzenesulfonamide;dihydrochloride (PubChem CID 24846272) has the molecular formula C18H28Cl2N4O2S and a molecular weight of 435.42 g/mol. Its IUPAC name is 4-amino-N-[2-(diethylamino)ethyl]-N-(pyridin-4-ylmethyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 4-amino-N-[2-(diethylamino)ethyl]-N-(pyridin-4-ylmethyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 24846272 |
| Molecular Formula | C18H28Cl2N4O2S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-amino-N-[2-(diethylamino)ethyl]-N-(pyridin-4-ylmethyl)benzenesulfonamide;dihydrochloride |
| SMILES | CCN(CC)CCN(Cc1ccncc1)S(=O)(=O)c1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C18H26N4O2S.2ClH/c1-3-21(4-2)13-14-22(15-16-9-11-20-12-10-16)25(23,24)18-7-5-17(19)6-8-18;;/h5-12H,3-4,13-15,19H2,1-2H3;2*1H |
| InChIKey | IBUPMKYRPYJTQA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|