C16H20N2O2S2 — CID 110759419
N-ethyl-4-methylsulfanyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide (PubChem CID 110759419) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-ethyl-4-methylsulfanyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide.
| Compound Name | N-ethyl-4-methylsulfanyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110759419 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-ethyl-4-methylsulfanyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
| SMILES | CCN(CCc1ccncc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C16H20N2O2S2/c1-3-18(13-10-14-8-11-17-12-9-14)22(19,20)16-6-4-15(21-2)5-7-16/h4-9,11-12H,3,10,13H2,1-2H3 |
| InChIKey | IEBFFCPXCAUHQX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |