C16H17N3O3S — CID 110759654
N-ethyl-N-(2-pyridin-4-ylethyl)-1,3-benzoxazole-6-sulfonamide (PubChem CID 110759654) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-ethyl-N-(2-pyridin-4-ylethyl)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-ethyl-N-(2-pyridin-4-ylethyl)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110759654 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-ethyl-N-(2-pyridin-4-ylethyl)-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCN(CCc1ccncc1)S(=O)(=O)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-2-19(10-7-13-5-8-17-9-6-13)23(20,21)14-3-4-15-16(11-14)22-12-18-15/h3-6,8-9,11-12H,2,7,10H2,1H3 |
| InChIKey | HSSOAEMRNSDXRM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |