C21H23ClN4+2 — CID 24848196
3-(benzo[b][1,10]phenanthrolin-1-ium-7-ylamino)propyl-(2-chloroethyl)azanium (PubChem CID 24848196) has the molecular formula C21H23ClN4+2 and a molecular weight of 366.90 g/mol. Its IUPAC name is 3-(benzo[b][1,10]phenanthrolin-1-ium-7-ylamino)propyl-(2-chloroethyl)azanium.
| Compound Name | 3-(benzo[b][1,10]phenanthrolin-1-ium-7-ylamino)propyl-(2-chloroethyl)azanium |
|---|---|
| PubChem CID | 24848196 |
| Molecular Formula | C21H23ClN4+2 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-(benzo[b][1,10]phenanthrolin-1-ium-7-ylamino)propyl-(2-chloroethyl)azanium |
| SMILES | ClCC[NH2+]CCCNc1c2ccccc2nc2c1ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C21H21ClN4/c22-10-14-23-11-4-13-25-20-16-6-1-2-7-18(16)26-21-17(20)9-8-15-5-3-12-24-19(15)21/h1-3,5-9,12,23H,4,10-11,13-14H2,(H,25,26)/p+2 |
| InChIKey | KBTBMHFTRXRADZ-UHFFFAOYSA-P |
| XLogP | 2.96 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|