About 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine
7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 24849785) has the molecular formula C14H12Cl2N4
and a molecular weight of 307.18 g/mol. Its IUPAC name is 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 24849785 |
| Molecular Formula | C14H12Cl2N4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | NCc1cc2ncc(N)n2cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4/c15-9-1-2-10(12(16)4-9)11-7-20-13(18)6-19-14(20)3-8(11)5-17/h1-4,6-7H,5,17-18H2 |
| InChIKey | ZZDGLUVPZDPPRC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine (CID 24849785) is 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine is NCc1cc2ncc(N)n2cc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine?
The InChIKey is ZZDGLUVPZDPPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N4/c15-9-1-2-10(12(16)4-9)11-7-20-13(18)6-19-14(20)3-8(11)5-17/h1-4,6-7H,5,17-18H2.
What are the key properties of 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine?
7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine has a molecular weight of 307.18 g/mol, XLogP of 3.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-6-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 24849785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).