C26H22FNO2S — CID 24850304
1-[[4-(5-benzyl-1-benzothiophen-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 24850304) has the molecular formula C26H22FNO2S and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[[4-(5-benzyl-1-benzothiophen-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(5-benzyl-1-benzothiophen-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 24850304 |
| Molecular Formula | C26H22FNO2S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-[[4-(5-benzyl-1-benzothiophen-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(-c3cc4cc(Cc5ccccc5)ccc4s3)c(F)c2)C1 |
| InChI | InChI=1S/C26H22FNO2S/c27-23-12-19(14-28-15-21(16-28)26(29)30)6-8-22(23)25-13-20-11-18(7-9-24(20)31-25)10-17-4-2-1-3-5-17/h1-9,11-13,21H,10,14-16H2,(H,29,30) |
| InChIKey | OQLNDRQADDEGLT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |