C25H22FN3O2 — CID 53324301
1-[[4-(6-benzylindazol-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 53324301) has the molecular formula C25H22FN3O2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-[[4-(6-benzylindazol-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(6-benzylindazol-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 53324301 |
| Molecular Formula | C25H22FN3O2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[[4-(6-benzylindazol-2-yl)-3-fluorophenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(-n3cc4ccc(Cc5ccccc5)cc4n3)c(F)c2)C1 |
| InChI | InChI=1S/C25H22FN3O2/c26-22-11-19(13-28-14-21(15-28)25(30)31)7-9-24(22)29-16-20-8-6-18(12-23(20)27-29)10-17-4-2-1-3-5-17/h1-9,11-12,16,21H,10,13-15H2,(H,30,31) |
| InChIKey | PTBDBLRCEHPRPZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |