C26H24FNO3 — CID 24853850
methyl 2-[[1-fluoro-4-(3-methoxyphenyl)-1,1-diphenylbut-3-yn-2-yl]amino]acetate (PubChem CID 24853850) has the molecular formula C26H24FNO3 and a molecular weight of 417.48 g/mol. Its IUPAC name is methyl 2-[[1-fluoro-4-(3-methoxyphenyl)-1,1-diphenylbut-3-yn-2-yl]amino]acetate.
| Compound Name | methyl 2-[[1-fluoro-4-(3-methoxyphenyl)-1,1-diphenylbut-3-yn-2-yl]amino]acetate |
|---|---|
| PubChem CID | 24853850 |
| Molecular Formula | C26H24FNO3 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | methyl 2-[[1-fluoro-4-(3-methoxyphenyl)-1,1-diphenylbut-3-yn-2-yl]amino]acetate |
| SMILES | COC(=O)CNC(C#Cc1cccc(OC)c1)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24FNO3/c1-30-23-15-9-10-20(18-23)16-17-24(28-19-25(29)31-2)26(27,21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-15,18,24,28H,19H2,1-2H3 |
| InChIKey | KUUJJTMTCJQKRA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|