C17H20Cl2O4 — CID 24854153
[(1S,5R,6R)-7,7-dichloro-6-bicyclo[3.2.0]hept-2-enyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 24854153) has the molecular formula C17H20Cl2O4 and a molecular weight of 359.25 g/mol. Its IUPAC name is [(1S,5R,6R)-7,7-dichloro-6-bicyclo[3.2.0]hept-2-enyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(1S,5R,6R)-7,7-dichloro-6-bicyclo[3.2.0]hept-2-enyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 24854153 |
| Molecular Formula | C17H20Cl2O4 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [(1S,5R,6R)-7,7-dichloro-6-bicyclo[3.2.0]hept-2-enyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)O[C@@H]1[C@@H]3CC=C[C@@H]3C1(Cl)Cl)OC2=O |
| InChI | InChI=1S/C17H20Cl2O4/c1-14(2)15(3)7-8-16(14,23-12(15)20)13(21)22-11-9-5-4-6-10(9)17(11,18)19/h4,6,9-11H,5,7-8H2,1-3H3/t9-,10+,11-,15+,16-/m1/s1 |
| InChIKey | MWMZOSGLKOQHMZ-CAWIRYAWSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|