C17H12N4OS — CID 24855051
3-[4-(2-amino-4-pyridinyl)thieno[3,2-d]pyrimidin-2-yl]phenol (PubChem CID 24855051) has the molecular formula C17H12N4OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 3-[4-(2-amino-4-pyridinyl)thieno[3,2-d]pyrimidin-2-yl]phenol.
| Compound Name | 3-[4-(2-amino-4-pyridinyl)thieno[3,2-d]pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 24855051 |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-[4-(2-amino-4-pyridinyl)thieno[3,2-d]pyrimidin-2-yl]phenol |
| SMILES | Nc1cc(-c2nc(-c3cccc(O)c3)nc3ccsc23)ccn1 |
| InChI | InChI=1S/C17H12N4OS/c18-14-9-10(4-6-19-14)15-16-13(5-7-23-16)20-17(21-15)11-2-1-3-12(22)8-11/h1-9,22H,(H2,18,19) |
| InChIKey | UKQJZKSEWHJSFE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |