C22H24N6O3S — CID 24855856
2-[6-[6-(2-hydroxyethylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 24855856) has the molecular formula C22H24N6O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-[6-[6-(2-hydroxyethylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-[6-[6-(2-hydroxyethylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 24855856 |
| Molecular Formula | C22H24N6O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[6-[6-(2-hydroxyethylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | CC1(C)Cc2nc(N3CCOc4ccc(-c5ccc(NCCO)nn5)cc43)sc2C(=O)N1 |
| InChI | InChI=1S/C22H24N6O3S/c1-22(2)12-15-19(20(30)25-22)32-21(24-15)28-8-10-31-17-5-3-13(11-16(17)28)14-4-6-18(27-26-14)23-7-9-29/h3-6,11,29H,7-10,12H2,1-2H3,(H,23,27)(H,25,30) |
| InChIKey | DSPBNSZNVFUZLF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |