C26H33N5O2S — CID 67188143
2-[6-[3,5-dimethyl-1-(3-methylbutyl)pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 67188143) has the molecular formula C26H33N5O2S and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-[6-[3,5-dimethyl-1-(3-methylbutyl)pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-[6-[3,5-dimethyl-1-(3-methylbutyl)pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 67188143 |
| Molecular Formula | C26H33N5O2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[6-[3,5-dimethyl-1-(3-methylbutyl)pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | Cc1nn(CCC(C)C)c(C)c1-c1ccc2c(c1)N(c1nc3c(s1)C(=O)NC(C)(C)C3)CCO2 |
| InChI | InChI=1S/C26H33N5O2S/c1-15(2)9-10-31-17(4)22(16(3)29-31)18-7-8-21-20(13-18)30(11-12-33-21)25-27-19-14-26(5,6)28-24(32)23(19)34-25/h7-8,13,15H,9-12,14H2,1-6H3,(H,28,32) |
| InChIKey | UDVGVUFMSHSQLX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |