C21H26FN3O4 — CID 24856593
N-(2-cyclopropyl-2-hydroxypropyl)-6-(4-fluorophenyl)-5-(3-methoxypropoxy)pyrazine-2-carboxamide (PubChem CID 24856593) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxypropyl)-6-(4-fluorophenyl)-5-(3-methoxypropoxy)pyrazine-2-carboxamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxypropyl)-6-(4-fluorophenyl)-5-(3-methoxypropoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 24856593 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxypropyl)-6-(4-fluorophenyl)-5-(3-methoxypropoxy)pyrazine-2-carboxamide |
| SMILES | COCCCOc1ncc(C(=O)NCC(C)(O)C2CC2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O4/c1-21(27,15-6-7-15)13-24-19(26)17-12-23-20(29-11-3-10-28-2)18(25-17)14-4-8-16(22)9-5-14/h4-5,8-9,12,15,27H,3,6-7,10-11,13H2,1-2H3,(H,24,26) |
| InChIKey | KLPJFERTVKNRCG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|