C20H23Cl2N3O4 — CID 86616973
N-(2-cyclopropyl-2-hydroxypropyl)-6-(2,4-dichlorophenyl)-5-(2-methoxyethoxy)pyrazine-2-carboxamide (PubChem CID 86616973) has the molecular formula C20H23Cl2N3O4 and a molecular weight of 440.33 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxypropyl)-6-(2,4-dichlorophenyl)-5-(2-methoxyethoxy)pyrazine-2-carboxamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxypropyl)-6-(2,4-dichlorophenyl)-5-(2-methoxyethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 86616973 |
| Molecular Formula | C20H23Cl2N3O4 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxypropyl)-6-(2,4-dichlorophenyl)-5-(2-methoxyethoxy)pyrazine-2-carboxamide |
| SMILES | COCCOc1ncc(C(=O)NCC(C)(O)C2CC2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O4/c1-20(27,12-3-4-12)11-24-18(26)16-10-23-19(29-8-7-28-2)17(25-16)14-6-5-13(21)9-15(14)22/h5-6,9-10,12,27H,3-4,7-8,11H2,1-2H3,(H,24,26) |
| InChIKey | SJDBDCLUIZSBMT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|