C21H26ClN3O3 — CID 11951477
5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide (PubChem CID 11951477) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11951477 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)-6-(2-methoxyethylamino)pyridine-3-carboxamide |
| SMILES | COCCNc1ncc(C(=O)NCC(C)(O)C2CC2)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-21(27,16-5-6-16)13-25-20(26)15-11-18(14-3-7-17(22)8-4-14)19(24-12-15)23-9-10-28-2/h3-4,7-8,11-12,16,27H,5-6,9-10,13H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | XIJCROVWBPYKHG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|