C21H27ClN2O4 — CID 21109684
5-(4-chlorophenyl)-N-[2-(hydroxymethyl)pentyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide (PubChem CID 21109684) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[2-(hydroxymethyl)pentyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[2-(hydroxymethyl)pentyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 21109684 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[2-(hydroxymethyl)pentyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide |
| SMILES | CCCC(CO)CNC(=O)c1cnc(OCCOC)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H27ClN2O4/c1-3-4-15(14-25)12-23-20(26)17-11-19(16-5-7-18(22)8-6-16)21(24-13-17)28-10-9-27-2/h5-8,11,13,15,25H,3-4,9-10,12,14H2,1-2H3,(H,23,26) |
| InChIKey | HOWWWKWECYWBME-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|