C31H44ClN3O4Si — CID 21109720
6-butoxy-5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)pyridine-3-carboxamide;2-cyclopropyl-2-trimethylsilyloxypropanenitrile (PubChem CID 21109720) has the molecular formula C31H44ClN3O4Si and a molecular weight of 586.25 g/mol. Its IUPAC name is 6-butoxy-5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)pyridine-3-carboxamide;2-cyclopropyl-2-trimethylsilyloxypropanenitrile.
| Compound Name | 6-butoxy-5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)pyridine-3-carboxamide;2-cyclopropyl-2-trimethylsilyloxypropanenitrile |
|---|---|
| PubChem CID | 21109720 |
| Molecular Formula | C31H44ClN3O4Si |
| Molecular Weight | 586.25 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | 6-butoxy-5-(4-chlorophenyl)-N-(2-cyclopropyl-2-hydroxypropyl)pyridine-3-carboxamide;2-cyclopropyl-2-trimethylsilyloxypropanenitrile |
| SMILES | CC(C#N)(O[Si](C)(C)C)C1CC1.CCCCOc1ncc(C(=O)NCC(C)(O)C2CC2)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O3.C9H17NOSi/c1-3-4-11-28-21-19(15-5-9-18(23)10-6-15)12-16(13-24-21)20(26)25-14-22(2,27)17-7-8-17;1-9(7-10,8-5-6-8)11-12(2,3)4/h5-6,9-10,12-13,17,27H,3-4,7-8,11,14H2,1-2H3,(H,25,26);8H,5-6H2,1-4H3 |
| InChIKey | GZCDIQUQSGECKG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.25 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|