C36H53NO3 — CID 24857282
[(1R,3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl pyridine-3-carboxylate (PubChem CID 24857282) has the molecular formula C36H53NO3 and a molecular weight of 547.82 g/mol. Its IUPAC name is [(1R,3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(1R,3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 24857282 |
| Molecular Formula | C36H53NO3 |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 547.40 |
| IUPAC Name | [(1R,3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl pyridine-3-carboxylate |
| SMILES | C=C(C)C1CC[C@]2(COC(=O)c3cccnc3)CC[C@]3(C)C(CCC4[C@@]5(C)CC[C@H](O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C36H53NO3/c1-23(2)25-12-17-36(22-40-31(39)24-9-8-20-37-21-24)19-18-34(6)26(30(25)36)10-11-28-33(5)15-14-29(38)32(3,4)27(33)13-16-35(28,34)7/h8-9,20-21,25-30,38H,1,10-19,22H2,2-7H3/t25?,26?,27?,28?,29-,30?,33-,34+,35+,36+/m0/s1 |
| InChIKey | GULOXBUIXZIYCT-VRMZJXFNSA-N |
| XLogP | 8.26 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|