C37H52O3 — CID 77353347
(5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl benzoate (PubChem CID 77353347) has the molecular formula C37H52O3 and a molecular weight of 544.82 g/mol. Its IUPAC name is (5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl benzoate.
| Compound Name | (5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl benzoate |
|---|---|
| PubChem CID | 77353347 |
| Molecular Formula | C37H52O3 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | (5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl benzoate |
| SMILES | C=C(C)C1CCC2(COC(=O)c3ccccc3)CCC3(C)C(CCC4C5(C)CCC(=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C37H52O3/c1-24(2)26-15-20-37(23-40-32(39)25-11-9-8-10-12-25)22-21-35(6)27(31(26)37)13-14-29-34(5)18-17-30(38)33(3,4)28(34)16-19-36(29,35)7/h8-12,26-29,31H,1,13-23H2,2-7H3 |
| InChIKey | QGIULFAYQLNVRL-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|