C18H15NO3S — CID 24858980
5-Methyl-6-(4-nitrophenyl)-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24858980) has the molecular formula C18H15NO3S and a molecular weight of 325.40 g/mol. Its IUPAC name is 5-methyl-6-(4-nitrophenyl)-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 5-Methyl-6-(4-nitrophenyl)-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 24858980 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-methyl-6-(4-nitrophenyl)-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1C(C(=CC=C1C2=CC=CS2)C=O)C3=CC=C(C=C3)[N+](=O)[O-] |
| InChI | InChI=1S/C18H15NO3S/c1-12-16(17-3-2-10-23-17)9-6-14(11-20)18(12)13-4-7-15(8-5-13)19(21)22/h2-12,18H,1H3 |
| InChIKey | VEUIHRBBGJVNNE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 529 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|