C24H20N2O — CID 24859408
4,6-bis(1H-indol-3-yl)-6-methylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24859408) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is 4,6-bis(1H-indol-3-yl)-6-methylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4,6-bis(1H-indol-3-yl)-6-methylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 24859408 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4,6-bis(1H-indol-3-yl)-6-methylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1(c2c[nH]c3ccccc23)CC(c2c[nH]c3ccccc23)=CC=C1C=O |
| InChI | InChI=1S/C24H20N2O/c1-24(21-14-26-23-9-5-3-7-19(21)23)12-16(10-11-17(24)15-27)20-13-25-22-8-4-2-6-18(20)22/h2-11,13-15,25-26H,12H2,1H3 |
| InChIKey | OILFCHMXKWGJIM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|