C21H15F3N6O3 — CID 24859989
1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]urea (PubChem CID 24859989) has the molecular formula C21H15F3N6O3 and a molecular weight of 456.38 g/mol. Its IUPAC name is 1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 24859989 |
| Molecular Formula | C21H15F3N6O3 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2cc[n+]([O-])cc2)cc1)Nc1cc(C(F)(F)F)ccc1-n1cncn1 |
| InChI | InChI=1S/C21H15F3N6O3/c22-21(23,24)14-1-6-19(30-13-25-12-26-30)18(11-14)28-20(31)27-15-2-4-16(5-3-15)33-17-7-9-29(32)10-8-17/h1-13H,(H2,27,28,31) |
| InChIKey | KTVVKWLJBHLGAF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|