C22H16F3N5O3 — CID 24859990
1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]urea (PubChem CID 24859990) has the molecular formula C22H16F3N5O3 and a molecular weight of 455.40 g/mol. Its IUPAC name is 1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 24859990 |
| Molecular Formula | C22H16F3N5O3 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[4-(1-oxidopyridin-1-ium-4-yl)oxyphenyl]-3-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2cc[n+]([O-])cc2)cc1)Nc1cc(C(F)(F)F)ccc1-n1cccn1 |
| InChI | InChI=1S/C22H16F3N5O3/c23-22(24,25)15-2-7-20(30-11-1-10-26-30)19(14-15)28-21(31)27-16-3-5-17(6-4-16)33-18-8-12-29(32)13-9-18/h1-14H,(H2,27,28,31) |
| InChIKey | ZVOORTVABXMBJB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|