C37H47FN4O5 — CID 24860636
(E,3R,5S)-7-[13-[4-(dimethylamino)butylcarbamoylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 24860636) has the molecular formula C37H47FN4O5 and a molecular weight of 646.80 g/mol. Its IUPAC name is (E,3R,5S)-7-[13-[4-(dimethylamino)butylcarbamoylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | (E,3R,5S)-7-[13-[4-(dimethylamino)butylcarbamoylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 24860636 |
| Molecular Formula | C37H47FN4O5 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | (E,3R,5S)-7-[13-[4-(dimethylamino)butylcarbamoylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)CCCc1cc(NC(=O)NCCCCN(C)C)ccc1-2 |
| InChI | InChI=1S/C37H47FN4O5/c1-23(2)35-32(17-15-28(43)21-29(44)22-33(45)46)34(24-10-12-26(38)13-11-24)31-9-7-8-25-20-27(14-16-30(25)36(31)41-35)40-37(47)39-18-5-6-19-42(3)4/h10-17,20,23,28-29,43-44H,5-9,18-19,21-22H2,1-4H3,(H,45,46)(H2,39,40,47)/b17-15+/t28-,29-/m1/s1 |
| InChIKey | KFXOLOKHXZQNHJ-AQXRZTRLSA-N |
| XLogP | 6.23 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|