C21H23NO7S — CID 24862899
2-[(4-methylsulfonylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile (PubChem CID 24862899) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-[(4-methylsulfonylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile.
| Compound Name | 2-[(4-methylsulfonylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 24862899 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[(4-methylsulfonylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
| SMILES | CS(=O)(=O)c1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2C#N)cc1 |
| InChI | InChI=1S/C21H23NO7S/c1-30(27,28)16-6-2-12(3-7-16)8-15-9-13(4-5-14(15)10-22)21-20(26)19(25)18(24)17(11-23)29-21/h2-7,9,17-21,23-26H,8,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | HGLXLICDHXFWCM-ADAARDCZSA-N |
| XLogP | 0.07 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |