C18H18ClN5 — CID 24862937
N'-[3-[2-(3-chloroanilino)pyrimidin-4-yl]phenyl]ethane-1,2-diamine (PubChem CID 24862937) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is N'-[3-[2-(3-chloroanilino)pyrimidin-4-yl]phenyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[2-(3-chloroanilino)pyrimidin-4-yl]phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 24862937 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N'-[3-[2-(3-chloroanilino)pyrimidin-4-yl]phenyl]ethane-1,2-diamine |
| SMILES | NCCNc1cccc(-c2ccnc(Nc3cccc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C18H18ClN5/c19-14-4-2-6-16(12-14)23-18-22-9-7-17(24-18)13-3-1-5-15(11-13)21-10-8-20/h1-7,9,11-12,21H,8,10,20H2,(H,22,23,24) |
| InChIKey | LPMRHUQKAWFYJW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |