C20H20ClF3N6 — CID 24864296
4-[[5-(6-chloro-3-pyridinyl)-1H-pyrazol-4-yl]methyl]-2-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 24864296) has the molecular formula C20H20ClF3N6 and a molecular weight of 436.87 g/mol. Its IUPAC name is 4-[[5-(6-chloro-3-pyridinyl)-1H-pyrazol-4-yl]methyl]-2-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 4-[[5-(6-chloro-3-pyridinyl)-1H-pyrazol-4-yl]methyl]-2-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 24864296 |
| Molecular Formula | C20H20ClF3N6 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-[[5-(6-chloro-3-pyridinyl)-1H-pyrazol-4-yl]methyl]-2-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | CC1CN(Cc2cn[nH]c2-c2ccc(Cl)nc2)CCN1c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H20ClF3N6/c1-13-11-29(6-7-30(13)18-5-3-16(10-26-18)20(22,23)24)12-15-9-27-28-19(15)14-2-4-17(21)25-8-14/h2-5,8-10,13H,6-7,11-12H2,1H3,(H,27,28) |
| InChIKey | SPKDMBCIQPGSLX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|