C20H23N5O2 — CID 24864678
3-[(2-anilinopyrimidin-4-yl)amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 24864678) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-[(2-anilinopyrimidin-4-yl)amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2-anilinopyrimidin-4-yl)amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 24864678 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-[(2-anilinopyrimidin-4-yl)amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(Nc2ccnc(Nc3ccccc3)n2)c(=O)c1=O)C(C)(C)C |
| InChI | InChI=1S/C20H23N5O2/c1-12(20(2,3)4)22-15-16(18(27)17(15)26)24-14-10-11-21-19(25-14)23-13-8-6-5-7-9-13/h5-12,22H,1-4H3,(H2,21,23,24,25)/t12-/m1/s1 |
| InChIKey | XEPATAODVVYZFR-GFCCVEGCSA-N |
| XLogP | 3.41 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|