C20H22BrN5O2 — CID 24864675
3-[[2-(4-bromoanilino)pyrimidin-4-yl]amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 24864675) has the molecular formula C20H22BrN5O2 and a molecular weight of 444.33 g/mol. Its IUPAC name is 3-[[2-(4-bromoanilino)pyrimidin-4-yl]amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[2-(4-bromoanilino)pyrimidin-4-yl]amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 24864675 |
| Molecular Formula | C20H22BrN5O2 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-[[2-(4-bromoanilino)pyrimidin-4-yl]amino]-4-[[(2R)-3,3-dimethylbutan-2-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(Nc2ccnc(Nc3ccc(Br)cc3)n2)c(=O)c1=O)C(C)(C)C |
| InChI | InChI=1S/C20H22BrN5O2/c1-11(20(2,3)4)23-15-16(18(28)17(15)27)25-14-9-10-22-19(26-14)24-13-7-5-12(21)6-8-13/h5-11,23H,1-4H3,(H2,22,24,25,26)/t11-/m1/s1 |
| InChIKey | SZCZWWAYTCJULU-LLVKDONJSA-N |
| XLogP | 4.17 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|