C22H17ClN4O — CID 24865435
5-[3-(2-chloroethoxy)phenyl]-4-(1H-indol-6-ylamino)pyridine-3-carbonitrile (PubChem CID 24865435) has the molecular formula C22H17ClN4O and a molecular weight of 388.86 g/mol. Its IUPAC name is 5-[3-(2-chloroethoxy)phenyl]-4-(1H-indol-6-ylamino)pyridine-3-carbonitrile.
| Compound Name | 5-[3-(2-chloroethoxy)phenyl]-4-(1H-indol-6-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 24865435 |
| Molecular Formula | C22H17ClN4O |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 5-[3-(2-chloroethoxy)phenyl]-4-(1H-indol-6-ylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(-c2cccc(OCCCl)c2)c1Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C22H17ClN4O/c23-7-9-28-19-3-1-2-16(10-19)20-14-25-13-17(12-24)22(20)27-18-5-4-15-6-8-26-21(15)11-18/h1-6,8,10-11,13-14,26H,7,9H2,(H,25,27) |
| InChIKey | SGTSTQNSJBGBPV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|