C30H28N6O2 — CID 68969109
4-(1H-indol-5-ylamino)-5-[4-methoxy-3-[2-(1-pyridin-3-ylethylamino)ethoxy]phenyl]pyridine-3-carbonitrile (PubChem CID 68969109) has the molecular formula C30H28N6O2 and a molecular weight of 504.59 g/mol. Its IUPAC name is 4-(1H-indol-5-ylamino)-5-[4-methoxy-3-[2-(1-pyridin-3-ylethylamino)ethoxy]phenyl]pyridine-3-carbonitrile.
| Compound Name | 4-(1H-indol-5-ylamino)-5-[4-methoxy-3-[2-(1-pyridin-3-ylethylamino)ethoxy]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 68969109 |
| Molecular Formula | C30H28N6O2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-(1H-indol-5-ylamino)-5-[4-methoxy-3-[2-(1-pyridin-3-ylethylamino)ethoxy]phenyl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cncc(C#N)c2Nc2ccc3[nH]ccc3c2)cc1OCCNC(C)c1cccnc1 |
| InChI | InChI=1S/C30H28N6O2/c1-20(23-4-3-10-32-17-23)34-12-13-38-29-15-21(5-8-28(29)37-2)26-19-33-18-24(16-31)30(26)36-25-6-7-27-22(14-25)9-11-35-27/h3-11,14-15,17-20,34-35H,12-13H2,1-2H3,(H,33,36) |
| InChIKey | IBNRMKYUKYYFQJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|