C33H33N5O2 — CID 118510446
5-[3-methoxy-4-[2-(1-phenylpropan-2-ylamino)ethoxy]phenyl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile (PubChem CID 118510446) has the molecular formula C33H33N5O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is 5-[3-methoxy-4-[2-(1-phenylpropan-2-ylamino)ethoxy]phenyl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 5-[3-methoxy-4-[2-(1-phenylpropan-2-ylamino)ethoxy]phenyl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118510446 |
| Molecular Formula | C33H33N5O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 5-[3-methoxy-4-[2-(1-phenylpropan-2-ylamino)ethoxy]phenyl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile |
| SMILES | COc1cc(-c2cncc(C#N)c2Nc2ccc3[nH]ccc3c2C)ccc1OCCNC(C)Cc1ccccc1 |
| InChI | InChI=1S/C33H33N5O2/c1-22(17-24-7-5-4-6-8-24)36-15-16-40-31-12-9-25(18-32(31)39-3)28-21-35-20-26(19-34)33(28)38-29-10-11-30-27(23(29)2)13-14-37-30/h4-14,18,20-22,36-37H,15-17H2,1-3H3,(H,35,38) |
| InChIKey | DWPRAOAEYTWTHN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|