C27H25N5O2 — CID 45485734
5-[5-[(3-hydroxypropylamino)methyl]-1-benzofuran-2-yl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile (PubChem CID 45485734) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 5-[5-[(3-hydroxypropylamino)methyl]-1-benzofuran-2-yl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 5-[5-[(3-hydroxypropylamino)methyl]-1-benzofuran-2-yl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 45485734 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 5-[5-[(3-hydroxypropylamino)methyl]-1-benzofuran-2-yl]-4-[(4-methyl-1H-indol-5-yl)amino]pyridine-3-carbonitrile |
| SMILES | Cc1c(Nc2c(C#N)cncc2-c2cc3cc(CNCCCO)ccc3o2)ccc2[nH]ccc12 |
| InChI | InChI=1S/C27H25N5O2/c1-17-21-7-9-31-24(21)5-4-23(17)32-27-20(13-28)15-30-16-22(27)26-12-19-11-18(3-6-25(19)34-26)14-29-8-2-10-33/h3-7,9,11-12,15-16,29,31,33H,2,8,10,14H2,1H3,(H,30,32) |
| InChIKey | IWPNPNGPAZFVCZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|