C10H7F5N2O — CID 24865870
5-(furan-2-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 24865870) has the molecular formula C10H7F5N2O and a molecular weight of 266.17 g/mol. Its IUPAC name is 5-(furan-2-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | 5-(furan-2-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 24865870 |
| Molecular Formula | C10H7F5N2O |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-(furan-2-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)cc1-c1ccco1 |
| InChI | InChI=1S/C10H7F5N2O/c1-17-6(7-3-2-4-18-7)5-8(16-17)9(11,12)10(13,14)15/h2-5H,1H3 |
| InChIKey | NPERYBPZVKGXTO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|