C18H17FN4OS — CID 24867104
(6S)-2-amino-6-[3-fluoro-4-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 24867104) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is (6S)-2-amino-6-[3-fluoro-4-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-[3-fluoro-4-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 24867104 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (6S)-2-amino-6-[3-fluoro-4-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | CC#Cc1cncc(-c2csc([C@]3(C)CC(=O)N(C)C(N)=N3)c2F)c1 |
| InChI | InChI=1S/C18H17FN4OS/c1-4-5-11-6-12(9-21-8-11)13-10-25-16(15(13)19)18(2)7-14(24)23(3)17(20)22-18/h6,8-10H,7H2,1-3H3,(H2,20,22)/t18-/m0/s1 |
| InChIKey | SEDXQPCBJKXYOY-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|