C24H25FO3 — CID 24867738
[(3Z)-3-[(2R,3S)-5-fluoro-3-methoxy-2-methyl-2,3-dihydroinden-1-ylidene]propyl] (E)-4-phenylbut-3-enoate (PubChem CID 24867738) has the molecular formula C24H25FO3 and a molecular weight of 380.46 g/mol. Its IUPAC name is [(3Z)-3-[(2R,3S)-5-fluoro-3-methoxy-2-methyl-2,3-dihydroinden-1-ylidene]propyl] (E)-4-phenylbut-3-enoate.
| Compound Name | [(3Z)-3-[(2R,3S)-5-fluoro-3-methoxy-2-methyl-2,3-dihydroinden-1-ylidene]propyl] (E)-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 24867738 |
| Molecular Formula | C24H25FO3 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(3Z)-3-[(2R,3S)-5-fluoro-3-methoxy-2-methyl-2,3-dihydroinden-1-ylidene]propyl] (E)-4-phenylbut-3-enoate |
| SMILES | CO[C@@H]1c2cc(F)ccc2/C(=C\CCOC(=O)C/C=C/c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C24H25FO3/c1-17-20(21-14-13-19(25)16-22(21)24(17)27-2)11-7-15-28-23(26)12-6-10-18-8-4-3-5-9-18/h3-6,8-11,13-14,16-17,24H,7,12,15H2,1-2H3/b10-6+,20-11-/t17-,24+/m1/s1 |
| InChIKey | FIUDYBYHOFXCMI-SDBNSGBPSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|