C19H27ClNO2S+ — CID 24868878
2-[(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]-6-methoxy-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-2-ium-7-ol (PubChem CID 24868878) has the molecular formula C19H27ClNO2S+ and a molecular weight of 368.95 g/mol. Its IUPAC name is 2-[(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]-6-methoxy-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-2-ium-7-ol.
| Compound Name | 2-[(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]-6-methoxy-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-2-ium-7-ol |
|---|---|
| PubChem CID | 24868878 |
| Molecular Formula | C19H27ClNO2S+ |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]-6-methoxy-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-2-ium-7-ol |
| SMILES | COC1CC2CC[N+](Cc3sc4c(c3Cl)CCCC4)=CC2CC1O |
| InChI | InChI=1S/C19H27ClNO2S/c1-23-16-9-12-6-7-21(10-13(12)8-15(16)22)11-18-19(20)14-4-2-3-5-17(14)24-18/h10,12-13,15-16,22H,2-9,11H2,1H3/q+1 |
| InChIKey | JCUSGNGUPHOCAW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|