2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid

C10H11ClO2S — CID 84794083

IUPAC2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid
SMILESO=C(O)Cc1sc2c(c1Cl)CCCC2
InChIInChI=1S/C10H11ClO2S/c11-10-6-3-1-2-4-7(6)14-8(10)5-9(12)13/h1-5H2,(H,12,13)
InChIKeyCTSREJJYIGQWIL-UHFFFAOYSA-N
MW230.72 g/mol
LogP2.91
Rot. Bonds2

About 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid

2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid (PubChem CID 84794083) has the molecular formula C10H11ClO2S and a molecular weight of 230.72 g/mol. Its IUPAC name is 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid.

Molecular Properties

Compound Name2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid
PubChem CID84794083
Molecular FormulaC10H11ClO2S
Molecular Weight230.72 g/mol
Exact Mass230.02
IUPAC Name2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid
SMILESO=C(O)Cc1sc2c(c1Cl)CCCC2
InChIInChI=1S/C10H11ClO2S/c11-10-6-3-1-2-4-7(6)14-8(10)5-9(12)13/h1-5H2,(H,12,13)
InChIKeyCTSREJJYIGQWIL-UHFFFAOYSA-N
XLogP2.91
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.72
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid?
The IUPAC name of 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid (CID 84794083) is 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid.
What is the SMILES notation for 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid?
The canonical SMILES for 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid is O=C(O)Cc1sc2c(c1Cl)CCCC2.
What is the InChIKey of 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid?
The InChIKey is CTSREJJYIGQWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2S/c11-10-6-3-1-2-4-7(6)14-8(10)5-9(12)13/h1-5H2,(H,12,13).
What are the key properties of 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid?
2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid has a molecular weight of 230.72 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetic acid is sourced from PubChem (CID 84794083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).