About 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine
3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine (PubChem CID 84766581) has the molecular formula C7H8ClNS
and a molecular weight of 173.67 g/mol. Its IUPAC name is 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine.
Analyze 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
The IUPAC name of 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine (CID 84766581) is 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine.
What is the SMILES notation for 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
The canonical SMILES for 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine is Nc1sc2c(c1Cl)CCC2.
What is the InChIKey of 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
The InChIKey is ZOJWRKGTPQUYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNS/c8-6-4-2-1-3-5(4)10-7(6)9/h1-3,9H2.
What are the key properties of 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine has a molecular weight of 173.67 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine is sourced from PubChem (CID 84766581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).