C23H24N4O5S — CID 24870624
1-[3-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidene-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide (PubChem CID 24870624) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is 1-[3-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidene-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidene-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24870624 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-[3-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidene-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(N2C(=O)C3C=CC(C(=O)N4CCC(C(N)=O)CC4)=CC3=NC2=S)c1 |
| InChI | InChI=1S/C23H24N4O5S/c1-31-15-4-6-19(32-2)18(12-15)27-22(30)16-5-3-14(11-17(16)25-23(27)33)21(29)26-9-7-13(8-10-26)20(24)28/h3-6,11-13,16H,7-10H2,1-2H3,(H2,24,28) |
| InChIKey | VKIVLRDDKTXHEL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|