C14H13ClN2O4S — CID 2487196
5-chloro-2-methoxy-N-(4-sulfamoylphenyl)benzamide (PubChem CID 2487196) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 5-chloro-2-methoxy-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 2487196 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 5-chloro-2-methoxy-N-(4-sulfamoylphenyl)benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H13ClN2O4S/c1-21-13-7-2-9(15)8-12(13)14(18)17-10-3-5-11(6-4-10)22(16,19)20/h2-8H,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | LUPLVWHJUHWLAK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |