C15H15ClN2O4S — CID 71764609
N-(2-chloro-4-sulfamoylphenyl)-2-(4-methoxyphenyl)acetamide (PubChem CID 71764609) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is N-(2-chloro-4-sulfamoylphenyl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-(2-chloro-4-sulfamoylphenyl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71764609 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-(2-chloro-4-sulfamoylphenyl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(S(N)(=O)=O)cc2Cl)cc1 |
| InChI | InChI=1S/C15H15ClN2O4S/c1-22-11-4-2-10(3-5-11)8-15(19)18-14-7-6-12(9-13(14)16)23(17,20)21/h2-7,9H,8H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | HJWWGJBIXYZPOQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |